C23H37N3O3 — CID 24877551
(1R,2S,5Z,11R,12R,16S)-2,16-dimethyl-5-[3-(methylamino)propoxyimino]-10-azatetracyclo[9.7.0.02,7.012,16]octadecane-9,15-dione (PubChem CID 24877551) has the molecular formula C23H37N3O3 and a molecular weight of 403.57 g/mol. Its IUPAC name is (1R,2S,5Z,11R,12R,16S)-2,16-dimethyl-5-[3-(methylamino)propoxyimino]-10-azatetracyclo[9.7.0.02,7.012,16]octadecane-9,15-dione.
| Compound Name | (1R,2S,5Z,11R,12R,16S)-2,16-dimethyl-5-[3-(methylamino)propoxyimino]-10-azatetracyclo[9.7.0.02,7.012,16]octadecane-9,15-dione |
|---|---|
| PubChem CID | 24877551 |
| Molecular Formula | C23H37N3O3 |
| Molecular Weight | 403.57 g/mol |
| Exact Mass | 403.28 |
| IUPAC Name | (1R,2S,5Z,11R,12R,16S)-2,16-dimethyl-5-[3-(methylamino)propoxyimino]-10-azatetracyclo[9.7.0.02,7.012,16]octadecane-9,15-dione |
| SMILES | CNCCCO/N=C1/CC[C@@]2(C)C(CC(=O)N[C@@H]3[C@@H]2CC[C@]2(C)C(=O)CC[C@@H]32)C1 |
| InChI | InChI=1S/C23H37N3O3/c1-22-9-7-16(26-29-12-4-11-24-3)13-15(22)14-20(28)25-21-17-5-6-19(27)23(17,2)10-8-18(21)22/h15,17-18,21,24H,4-14H2,1-3H3,(H,25,28)/b26-16-/t15?,17-,18-,21-,22-,23-/m0/s1 |
| InChIKey | WOLYKXOWYSHSGO-AZCRXEBJSA-N |
| XLogP | 3.06 |
| TPSA | 79.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.57 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|