C23H40ClN3O2 — CID 87725963
(6Z,8R,9R,10R,13S,14S)-3-(4-aminobutylamino)-6-hydroxyimino-10,13-dimethyl-2,3,4,5,7,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-17-one;hydrochloride (PubChem CID 87725963) has the molecular formula C23H40ClN3O2 and a molecular weight of 426.05 g/mol. Its IUPAC name is (6Z,8R,9R,10R,13S,14S)-3-(4-aminobutylamino)-6-hydroxyimino-10,13-dimethyl-2,3,4,5,7,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-17-one;hydrochloride.
| Compound Name | (6Z,8R,9R,10R,13S,14S)-3-(4-aminobutylamino)-6-hydroxyimino-10,13-dimethyl-2,3,4,5,7,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-17-one;hydrochloride |
|---|---|
| PubChem CID | 87725963 |
| Molecular Formula | C23H40ClN3O2 |
| Molecular Weight | 426.05 g/mol |
| Exact Mass | 425.28 |
| IUPAC Name | (6Z,8R,9R,10R,13S,14S)-3-(4-aminobutylamino)-6-hydroxyimino-10,13-dimethyl-2,3,4,5,7,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-17-one;hydrochloride |
| SMILES | C[C@]12CCC(NCCCCN)CC1/C(=N\O)C[C@@H]1[C@H]2CC[C@]2(C)C(=O)CC[C@@H]12.Cl |
| InChI | InChI=1S/C23H39N3O2.ClH/c1-22-9-7-15(25-12-4-3-11-24)13-19(22)20(26-28)14-16-17-5-6-21(27)23(17,2)10-8-18(16)22;/h15-19,25,28H,3-14,24H2,1-2H3;1H/b26-20-;/t15?,16-,17-,18+,19?,22+,23-;/m0./s1 |
| InChIKey | RCDXWYBKUFVJLH-ODPSIJKLSA-N |
| XLogP | 4.16 |
| TPSA | 87.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.05 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|