C23H35NO5 — CID 154090792
N-[(2S,3R,6S,11R,12S,15R)-11,15-dimethyl-18,21,22,25-tetraoxahexacyclo[15.4.4.01,17.02,15.03,12.06,11]pentacosan-5-ylidene]hydroxylamine (PubChem CID 154090792) has the molecular formula C23H35NO5 and a molecular weight of 405.54 g/mol. Its IUPAC name is N-[(2S,3R,6S,11R,12S,15R)-11,15-dimethyl-18,21,22,25-tetraoxahexacyclo[15.4.4.01,17.02,15.03,12.06,11]pentacosan-5-ylidene]hydroxylamine.
| Compound Name | N-[(2S,3R,6S,11R,12S,15R)-11,15-dimethyl-18,21,22,25-tetraoxahexacyclo[15.4.4.01,17.02,15.03,12.06,11]pentacosan-5-ylidene]hydroxylamine |
|---|---|
| PubChem CID | 154090792 |
| Molecular Formula | C23H35NO5 |
| Molecular Weight | 405.54 g/mol |
| Exact Mass | 405.25 |
| IUPAC Name | N-[(2S,3R,6S,11R,12S,15R)-11,15-dimethyl-18,21,22,25-tetraoxahexacyclo[15.4.4.01,17.02,15.03,12.06,11]pentacosan-5-ylidene]hydroxylamine |
| SMILES | C[C@]12CC[C@H]3[C@@H](CC(=NO)[C@H]4CCCC[C@@]43C)[C@@H]1C13OCCOC1(C2)OCCO3 |
| InChI | InChI=1S/C23H35NO5/c1-20-8-6-16-15(13-18(24-25)17-5-3-4-7-21(16,17)2)19(20)23-22(14-20,26-9-11-28-23)27-10-12-29-23/h15-17,19,25H,3-14H2,1-2H3/t15-,16+,17-,19+,20-,21-,22?,23?/m1/s1 |
| InChIKey | HQFWAHKCBIGHQZ-OHOAVPJRSA-N |
| XLogP | 3.96 |
| TPSA | 69.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.54 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|