C11H16O2 — CID 102589367
(3aR,7aS)-7a-ethyl-2,3,3a,4,6,7-hexahydroindene-1,5-dione (PubChem CID 102589367) has the molecular formula C11H16O2 and a molecular weight of 180.25 g/mol. Its IUPAC name is (3aR,7aS)-7a-ethyl-2,3,3a,4,6,7-hexahydroindene-1,5-dione.
| Compound Name | (3aR,7aS)-7a-ethyl-2,3,3a,4,6,7-hexahydroindene-1,5-dione |
|---|---|
| PubChem CID | 102589367 |
| Molecular Formula | C11H16O2 |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.12 |
| IUPAC Name | (3aR,7aS)-7a-ethyl-2,3,3a,4,6,7-hexahydroindene-1,5-dione |
| SMILES | CC[C@]12CCC(=O)C[C@H]1CCC2=O |
| InChI | InChI=1S/C11H16O2/c1-2-11-6-5-9(12)7-8(11)3-4-10(11)13/h8H,2-7H2,1H3/t8-,11+/m1/s1 |
| InChIKey | NSHQQPDYRQOVFN-KCJUWKMLSA-N |
| XLogP | 2.11 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |