C9H14OS — CID 102318785
(3aS,7aS)-7a-methyl-2,3,3a,4,6,7-hexahydro-1-benzothiophen-5-one (PubChem CID 102318785) has the molecular formula C9H14OS and a molecular weight of 170.28 g/mol. Its IUPAC name is (3aS,7aS)-7a-methyl-2,3,3a,4,6,7-hexahydro-1-benzothiophen-5-one.
| Compound Name | (3aS,7aS)-7a-methyl-2,3,3a,4,6,7-hexahydro-1-benzothiophen-5-one |
|---|---|
| PubChem CID | 102318785 |
| Molecular Formula | C9H14OS |
| Molecular Weight | 170.28 g/mol |
| Exact Mass | 170.08 |
| IUPAC Name | (3aS,7aS)-7a-methyl-2,3,3a,4,6,7-hexahydro-1-benzothiophen-5-one |
| SMILES | C[C@]12CCC(=O)C[C@H]1CCS2 |
| InChI | InChI=1S/C9H14OS/c1-9-4-2-8(10)6-7(9)3-5-11-9/h7H,2-6H2,1H3/t7-,9+/m1/s1 |
| InChIKey | WAKMIKSWQAQPMV-APPZFPTMSA-N |
| XLogP | 2.25 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.28 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |