C26H44O3Si — CID 6431267
(6S)-1,5,6-trimethyl-6-trimethylsilyloxy-18-oxapentacyclo[11.8.0.02,10.05,9.015,20]henicosan-17-one (PubChem CID 6431267) has the molecular formula C26H44O3Si and a molecular weight of 432.72 g/mol. Its IUPAC name is (6S)-1,5,6-trimethyl-6-trimethylsilyloxy-18-oxapentacyclo[11.8.0.02,10.05,9.015,20]henicosan-17-one.
| Compound Name | (6S)-1,5,6-trimethyl-6-trimethylsilyloxy-18-oxapentacyclo[11.8.0.02,10.05,9.015,20]henicosan-17-one |
|---|---|
| PubChem CID | 6431267 |
| Molecular Formula | C26H44O3Si |
| Molecular Weight | 432.72 g/mol |
| Exact Mass | 432.31 |
| IUPAC Name | (6S)-1,5,6-trimethyl-6-trimethylsilyloxy-18-oxapentacyclo[11.8.0.02,10.05,9.015,20]henicosan-17-one |
| SMILES | CC12CC3COC(=O)CC3CC1CCC1C2CCC2(C)C1CC[C@]2(C)O[Si](C)(C)C |
| InChI | InChI=1S/C26H44O3Si/c1-24-15-18-16-28-23(27)14-17(18)13-19(24)7-8-20-21(24)9-11-25(2)22(20)10-12-26(25,3)29-30(4,5)6/h17-22H,7-16H2,1-6H3/t17?,18?,19?,20?,21?,22?,24?,25?,26-/m0/s1 |
| InChIKey | YFPQNKZZKNAAJO-QXKFTYLJSA-N |
| XLogP | 6.43 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.72 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|