C22H33BrO3 — CID 67872141
[(8R,9R,10S,13S,14S)-2-bromo-10,13,17-trimethyl-3-oxo-2,4,5,6,7,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl] acetate (PubChem CID 67872141) has the molecular formula C22H33BrO3 and a molecular weight of 425.41 g/mol. Its IUPAC name is [(8R,9R,10S,13S,14S)-2-bromo-10,13,17-trimethyl-3-oxo-2,4,5,6,7,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl] acetate.
| Compound Name | [(8R,9R,10S,13S,14S)-2-bromo-10,13,17-trimethyl-3-oxo-2,4,5,6,7,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl] acetate |
|---|---|
| PubChem CID | 67872141 |
| Molecular Formula | C22H33BrO3 |
| Molecular Weight | 425.41 g/mol |
| Exact Mass | 424.16 |
| IUPAC Name | [(8R,9R,10S,13S,14S)-2-bromo-10,13,17-trimethyl-3-oxo-2,4,5,6,7,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl] acetate |
| SMILES | CC(=O)OC1(C)CC[C@H]2[C@@H]3CCC4CC(=O)C(Br)C[C@]4(C)[C@@H]3CC[C@@]21C |
| InChI | InChI=1S/C22H33BrO3/c1-13(24)26-22(4)10-8-17-15-6-5-14-11-19(25)18(23)12-20(14,2)16(15)7-9-21(17,22)3/h14-18H,5-12H2,1-4H3/t14?,15-,16-,17+,18?,20+,21+,22?/m1/s1 |
| InChIKey | LDGJOYFDOTYAMG-LZRRSYLNSA-N |
| XLogP | 5.29 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.41 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|