C24H35BrO5 — CID 25422756
[2-[(2R,5S,8S,9R,10S,13S,14R,16R,17R)-2-bromo-17-hydroxy-10,13,16-trimethyl-3-oxo-2,4,5,6,7,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-oxoethyl] acetate (PubChem CID 25422756) has the molecular formula C24H35BrO5 and a molecular weight of 483.44 g/mol. Its IUPAC name is [2-[(2R,5S,8S,9R,10S,13S,14R,16R,17R)-2-bromo-17-hydroxy-10,13,16-trimethyl-3-oxo-2,4,5,6,7,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-oxoethyl] acetate.
| Compound Name | [2-[(2R,5S,8S,9R,10S,13S,14R,16R,17R)-2-bromo-17-hydroxy-10,13,16-trimethyl-3-oxo-2,4,5,6,7,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-oxoethyl] acetate |
|---|---|
| PubChem CID | 25422756 |
| Molecular Formula | C24H35BrO5 |
| Molecular Weight | 483.44 g/mol |
| Exact Mass | 482.17 |
| IUPAC Name | [2-[(2R,5S,8S,9R,10S,13S,14R,16R,17R)-2-bromo-17-hydroxy-10,13,16-trimethyl-3-oxo-2,4,5,6,7,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-oxoethyl] acetate |
| SMILES | CC(=O)OCC(=O)[C@@]1(O)[C@H](C)C[C@@H]2[C@H]3CC[C@H]4CC(=O)[C@H](Br)C[C@]4(C)[C@@H]3CC[C@@]21C |
| InChI | InChI=1S/C24H35BrO5/c1-13-9-18-16-6-5-15-10-20(27)19(25)11-22(15,3)17(16)7-8-23(18,4)24(13,29)21(28)12-30-14(2)26/h13,15-19,29H,5-12H2,1-4H3/t13-,15+,16+,17-,18-,19-,22+,23+,24+/m1/s1 |
| InChIKey | AEDZUDVIFQHWGD-IHKHPWFFSA-N |
| XLogP | 4.08 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.44 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|