C23H36O2 — CID 152743413
(4R)-4-[(8R,9S,10S,13S,14R)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]oxolan-2-one (PubChem CID 152743413) has the molecular formula C23H36O2 and a molecular weight of 344.54 g/mol. Its IUPAC name is (4R)-4-[(8R,9S,10S,13S,14R)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]oxolan-2-one.
| Compound Name | (4R)-4-[(8R,9S,10S,13S,14R)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]oxolan-2-one |
|---|---|
| PubChem CID | 152743413 |
| Molecular Formula | C23H36O2 |
| Molecular Weight | 344.54 g/mol |
| Exact Mass | 344.27 |
| IUPAC Name | (4R)-4-[(8R,9S,10S,13S,14R)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]oxolan-2-one |
| SMILES | C[C@]12CCCCC1CC[C@H]1[C@H]3CCC([C@@H]4COC(=O)C4)[C@@]3(C)CC[C@@H]12 |
| InChI | InChI=1S/C23H36O2/c1-22-11-4-3-5-16(22)6-7-17-19-9-8-18(15-13-21(24)25-14-15)23(19,2)12-10-20(17)22/h15-20H,3-14H2,1-2H3/t15-,16?,17-,18?,19+,20-,22-,23+/m0/s1 |
| InChIKey | AQARKTASOBROAE-DMBPOFJCSA-N |
| XLogP | 5.60 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.54 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |