C23H32O3 — CID 88798354
(8S,9S,10S,13S,14R,17R)-13-methyl-17-[(3R)-5-oxooxolan-3-yl]-4,5,6,7,8,9,11,12,14,15,16,17-dodecahydro-3H-cyclopenta[a]phenanthrene-10-carbaldehyde (PubChem CID 88798354) has the molecular formula C23H32O3 and a molecular weight of 356.51 g/mol. Its IUPAC name is (8S,9S,10S,13S,14R,17R)-13-methyl-17-[(3R)-5-oxooxolan-3-yl]-4,5,6,7,8,9,11,12,14,15,16,17-dodecahydro-3H-cyclopenta[a]phenanthrene-10-carbaldehyde.
| Compound Name | (8S,9S,10S,13S,14R,17R)-13-methyl-17-[(3R)-5-oxooxolan-3-yl]-4,5,6,7,8,9,11,12,14,15,16,17-dodecahydro-3H-cyclopenta[a]phenanthrene-10-carbaldehyde |
|---|---|
| PubChem CID | 88798354 |
| Molecular Formula | C23H32O3 |
| Molecular Weight | 356.51 g/mol |
| Exact Mass | 356.24 |
| IUPAC Name | (8S,9S,10S,13S,14R,17R)-13-methyl-17-[(3R)-5-oxooxolan-3-yl]-4,5,6,7,8,9,11,12,14,15,16,17-dodecahydro-3H-cyclopenta[a]phenanthrene-10-carbaldehyde |
| SMILES | C[C@]12CC[C@H]3[C@@H](CCC4CCC=C[C@@]43C=O)[C@H]1CC[C@@H]2[C@@H]1COC(=O)C1 |
| InChI | InChI=1S/C23H32O3/c1-22-11-9-20-17(6-5-16-4-2-3-10-23(16,20)14-24)19(22)8-7-18(22)15-12-21(25)26-13-15/h3,10,14-20H,2,4-9,11-13H2,1H3/t15-,16?,17-,18+,19+,20-,22+,23+/m0/s1 |
| InChIKey | JRJSEHSSOXFHGJ-WDMYDDAISA-N |
| XLogP | 4.55 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.51 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|