C24H35NaO2 — CID 173328728
sodium;(5R)-5-[(8S,9S,10S,13S,14R,17R)-10,13-dimethyl-6,7,8,9,11,12,14,15,16,17-decahydro-5H-cyclopenta[a]phenanthren-17-yl]oxan-2-one;hydride (PubChem CID 173328728) has the molecular formula C24H35NaO2 and a molecular weight of 378.53 g/mol. Its IUPAC name is sodium;(5R)-5-[(8S,9S,10S,13S,14R,17R)-10,13-dimethyl-6,7,8,9,11,12,14,15,16,17-decahydro-5H-cyclopenta[a]phenanthren-17-yl]oxan-2-one;hydride.
| Compound Name | sodium;(5R)-5-[(8S,9S,10S,13S,14R,17R)-10,13-dimethyl-6,7,8,9,11,12,14,15,16,17-decahydro-5H-cyclopenta[a]phenanthren-17-yl]oxan-2-one;hydride |
|---|---|
| PubChem CID | 173328728 |
| Molecular Formula | C24H35NaO2 |
| Molecular Weight | 378.53 g/mol |
| Exact Mass | 378.25 |
| IUPAC Name | sodium;(5R)-5-[(8S,9S,10S,13S,14R,17R)-10,13-dimethyl-6,7,8,9,11,12,14,15,16,17-decahydro-5H-cyclopenta[a]phenanthren-17-yl]oxan-2-one;hydride |
| SMILES | C[C@]12CC[C@H]3[C@@H](CCC4C=CC=C[C@@]43C)[C@H]1CC[C@@H]2[C@H]1CCC(=O)OC1.[H-].[Na+] |
| InChI | InChI=1S/C24H34O2.Na.H/c1-23-13-4-3-5-17(23)7-8-18-20-10-9-19(16-6-11-22(25)26-15-16)24(20,2)14-12-21(18)23;;/h3-5,13,16-21H,6-12,14-15H2,1-2H3;;/q;+1;-1/t16-,17?,18-,19+,20+,21-,23-,24+;;/m0../s1 |
| InChIKey | FMWNWRGVWTTYME-VWKRLTJCSA-N |
| XLogP | 2.66 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.53 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |