C21H31N — CID 154293719
(5R,8R,9S,10S,13S,14S)-N,N,10,13-tetramethyl-6,7,8,9,11,12,14,15-octahydro-5H-cyclopenta[a]phenanthren-17-amine (PubChem CID 154293719) has the molecular formula C21H31N and a molecular weight of 297.49 g/mol. Its IUPAC name is (5R,8R,9S,10S,13S,14S)-N,N,10,13-tetramethyl-6,7,8,9,11,12,14,15-octahydro-5H-cyclopenta[a]phenanthren-17-amine.
| Compound Name | (5R,8R,9S,10S,13S,14S)-N,N,10,13-tetramethyl-6,7,8,9,11,12,14,15-octahydro-5H-cyclopenta[a]phenanthren-17-amine |
|---|---|
| PubChem CID | 154293719 |
| Molecular Formula | C21H31N |
| Molecular Weight | 297.49 g/mol |
| Exact Mass | 297.25 |
| IUPAC Name | (5R,8R,9S,10S,13S,14S)-N,N,10,13-tetramethyl-6,7,8,9,11,12,14,15-octahydro-5H-cyclopenta[a]phenanthren-17-amine |
| SMILES | CN(C)C1=CC[C@H]2[C@@H]3CC[C@@H]4C=CC=C[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C21H31N/c1-20-13-6-5-7-15(20)8-9-16-17-10-11-19(22(3)4)21(17,2)14-12-18(16)20/h5-7,11,13,15-18H,8-10,12,14H2,1-4H3/t15-,16-,17-,18-,20-,21-/m0/s1 |
| InChIKey | PNPVSBCCPGHQDW-ZKHIMWLXSA-N |
| XLogP | 5.03 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.49 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |