C21H33N — CID 154191384
(8S,9S,10R,13S,14S)-N,N,10,13-tetramethyl-6,7,8,9,11,12,14,15,16,17-decahydro-5H-cyclopenta[a]phenanthren-3-amine (PubChem CID 154191384) has the molecular formula C21H33N and a molecular weight of 299.50 g/mol. Its IUPAC name is (8S,9S,10R,13S,14S)-N,N,10,13-tetramethyl-6,7,8,9,11,12,14,15,16,17-decahydro-5H-cyclopenta[a]phenanthren-3-amine.
| Compound Name | (8S,9S,10R,13S,14S)-N,N,10,13-tetramethyl-6,7,8,9,11,12,14,15,16,17-decahydro-5H-cyclopenta[a]phenanthren-3-amine |
|---|---|
| PubChem CID | 154191384 |
| Molecular Formula | C21H33N |
| Molecular Weight | 299.50 g/mol |
| Exact Mass | 299.26 |
| IUPAC Name | (8S,9S,10R,13S,14S)-N,N,10,13-tetramethyl-6,7,8,9,11,12,14,15,16,17-decahydro-5H-cyclopenta[a]phenanthren-3-amine |
| SMILES | CN(C)C1=CC2CC[C@H]3[C@@H]4CCC[C@@]4(C)CC[C@@H]3[C@@]2(C)C=C1 |
| InChI | InChI=1S/C21H33N/c1-20-11-5-6-18(20)17-8-7-15-14-16(22(3)4)9-13-21(15,2)19(17)10-12-20/h9,13-15,17-19H,5-8,10-12H2,1-4H3/t15?,17-,18-,19-,20-,21-/m0/s1 |
| InChIKey | CLHPNFPDENGXQJ-RZHSAGOMSA-N |
| XLogP | 5.25 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.50 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |