C20H28F4O3S — CID 159146268
(5R,8S,9S,10R,13S,14S)-4-fluoro-10,13-dimethyl-6,7,8,9,11,12,14,15,16,17-decahydro-5H-cyclopenta[a]phenanthrene;trifluoromethanesulfonic acid (PubChem CID 159146268) has the molecular formula C20H28F4O3S and a molecular weight of 424.50 g/mol. Its IUPAC name is (5R,8S,9S,10R,13S,14S)-4-fluoro-10,13-dimethyl-6,7,8,9,11,12,14,15,16,17-decahydro-5H-cyclopenta[a]phenanthrene;trifluoromethanesulfonic acid.
| Compound Name | (5R,8S,9S,10R,13S,14S)-4-fluoro-10,13-dimethyl-6,7,8,9,11,12,14,15,16,17-decahydro-5H-cyclopenta[a]phenanthrene;trifluoromethanesulfonic acid |
|---|---|
| PubChem CID | 159146268 |
| Molecular Formula | C20H28F4O3S |
| Molecular Weight | 424.50 g/mol |
| Exact Mass | 424.17 |
| IUPAC Name | (5R,8S,9S,10R,13S,14S)-4-fluoro-10,13-dimethyl-6,7,8,9,11,12,14,15,16,17-decahydro-5H-cyclopenta[a]phenanthrene;trifluoromethanesulfonic acid |
| SMILES | C[C@@]12CCC[C@H]1[C@@H]1CC[C@H]3C(F)=CC=C[C@]3(C)[C@H]1CC2.O=S(=O)(O)C(F)(F)F |
| InChI | InChI=1S/C19H27F.CHF3O3S/c1-18-10-3-5-14(18)13-7-8-16-17(20)6-4-11-19(16,2)15(13)9-12-18;2-1(3,4)8(5,6)7/h4,6,11,13-16H,3,5,7-10,12H2,1-2H3;(H,5,6,7)/t13-,14-,15-,16-,18-,19+;/m0./s1 |
| InChIKey | KISJMZHPXZWWPL-BPEYRCGCSA-N |
| XLogP | 6.05 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.50 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|