C21H37N — CID 22214729
(8S,9S,10S,13S,14S)-N,N,10,13-tetramethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-1-amine (PubChem CID 22214729) has the molecular formula C21H37N and a molecular weight of 303.53 g/mol. Its IUPAC name is (8S,9S,10S,13S,14S)-N,N,10,13-tetramethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-1-amine.
| Compound Name | (8S,9S,10S,13S,14S)-N,N,10,13-tetramethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-1-amine |
|---|---|
| PubChem CID | 22214729 |
| Molecular Formula | C21H37N |
| Molecular Weight | 303.53 g/mol |
| Exact Mass | 303.29 |
| IUPAC Name | (8S,9S,10S,13S,14S)-N,N,10,13-tetramethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-1-amine |
| SMILES | CN(C)C1CCCC2CC[C@H]3[C@@H]4CCC[C@@]4(C)CC[C@@H]3[C@]21C |
| InChI | InChI=1S/C21H37N/c1-20-13-6-8-17(20)16-11-10-15-7-5-9-19(22(3)4)21(15,2)18(16)12-14-20/h15-19H,5-14H2,1-4H3/t15?,16-,17-,18-,19?,20-,21-/m0/s1 |
| InChIKey | NSDLQMFEDULGQT-VVCMQVJSSA-N |
| XLogP | 5.35 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.53 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |