C19H30O — CID 154189774
(1S,8S,9S,10S,13S,14S)-10,13-dimethyl-4,5,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-1-ol (PubChem CID 154189774) has the molecular formula C19H30O and a molecular weight of 274.45 g/mol. Its IUPAC name is (1S,8S,9S,10S,13S,14S)-10,13-dimethyl-4,5,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-1-ol.
| Compound Name | (1S,8S,9S,10S,13S,14S)-10,13-dimethyl-4,5,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-1-ol |
|---|---|
| PubChem CID | 154189774 |
| Molecular Formula | C19H30O |
| Molecular Weight | 274.45 g/mol |
| Exact Mass | 274.23 |
| IUPAC Name | (1S,8S,9S,10S,13S,14S)-10,13-dimethyl-4,5,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-1-ol |
| SMILES | C[C@@]12CCC[C@H]1[C@@H]1CCC3CC=C[C@H](O)[C@]3(C)[C@H]1CC2 |
| InChI | InChI=1S/C19H30O/c1-18-11-4-6-15(18)14-9-8-13-5-3-7-17(20)19(13,2)16(14)10-12-18/h3,7,13-17,20H,4-6,8-12H2,1-2H3/t13?,14-,15-,16-,17-,18-,19-/m0/s1 |
| InChIKey | SIUHWXTXOHDSRM-SSCHMFMQSA-N |
| XLogP | 4.56 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.45 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|