C19H30O2 — CID 172679291
(5R,8S,9S,10R,13S,14S)-13-methyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthrene-10-carboxylic acid (PubChem CID 172679291) has the molecular formula C19H30O2 and a molecular weight of 290.45 g/mol. Its IUPAC name is (5R,8S,9S,10R,13S,14S)-13-methyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthrene-10-carboxylic acid.
| Compound Name | (5R,8S,9S,10R,13S,14S)-13-methyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthrene-10-carboxylic acid |
|---|---|
| PubChem CID | 172679291 |
| Molecular Formula | C19H30O2 |
| Molecular Weight | 290.45 g/mol |
| Exact Mass | 290.22 |
| IUPAC Name | (5R,8S,9S,10R,13S,14S)-13-methyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthrene-10-carboxylic acid |
| SMILES | C[C@@]12CCC[C@H]1[C@@H]1CC[C@H]3CCCC[C@]3(C(=O)O)[C@H]1CC2 |
| InChI | InChI=1S/C19H30O2/c1-18-10-4-6-15(18)14-8-7-13-5-2-3-11-19(13,17(20)21)16(14)9-12-18/h13-16H,2-12H2,1H3,(H,20,21)/t13-,14+,15+,16+,18+,19-/m1/s1 |
| InChIKey | AEFZKDIJCCBNHS-JAOLZEGWSA-N |
| XLogP | 4.87 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.45 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |