C26H38O2 — CID 174789546
benzoic acid;(8S,9S,10S,13S,14S)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthrene (PubChem CID 174789546) has the molecular formula C26H38O2 and a molecular weight of 382.59 g/mol. Its IUPAC name is benzoic acid;(8S,9S,10S,13S,14S)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthrene.
| Compound Name | benzoic acid;(8S,9S,10S,13S,14S)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthrene |
|---|---|
| PubChem CID | 174789546 |
| Molecular Formula | C26H38O2 |
| Molecular Weight | 382.59 g/mol |
| Exact Mass | 382.29 |
| IUPAC Name | benzoic acid;(8S,9S,10S,13S,14S)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthrene |
| SMILES | C[C@@]12CCC[C@H]1[C@@H]1CCC3CCCC[C@]3(C)[C@H]1CC2.O=C(O)c1ccccc1 |
| InChI | InChI=1S/C19H32.C7H6O2/c1-18-11-5-7-16(18)15-9-8-14-6-3-4-12-19(14,2)17(15)10-13-18;8-7(9)6-4-2-1-3-5-6/h14-17H,3-13H2,1-2H3;1-5H,(H,8,9)/t14?,15-,16-,17-,18-,19-;/m0./s1 |
| InChIKey | WWIDFSRBEVDWQI-AKBADMEDSA-N |
| XLogP | 7.19 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.59 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |