C22H35NO — CID 161002179
(5R,8S,9S,10S,13S,14S)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthrene;1,2-oxazole (PubChem CID 161002179) has the molecular formula C22H35NO and a molecular weight of 329.53 g/mol. Its IUPAC name is (5R,8S,9S,10S,13S,14S)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthrene;1,2-oxazole.
| Compound Name | (5R,8S,9S,10S,13S,14S)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthrene;1,2-oxazole |
|---|---|
| PubChem CID | 161002179 |
| Molecular Formula | C22H35NO |
| Molecular Weight | 329.53 g/mol |
| Exact Mass | 329.27 |
| IUPAC Name | (5R,8S,9S,10S,13S,14S)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthrene;1,2-oxazole |
| SMILES | C[C@@]12CCC[C@H]1[C@@H]1CC[C@H]3CCCC[C@]3(C)[C@H]1CC2.c1cnoc1 |
| InChI | InChI=1S/C19H32.C3H3NO/c1-18-11-5-7-16(18)15-9-8-14-6-3-4-12-19(14,2)17(15)10-13-18;1-2-4-5-3-1/h14-17H,3-13H2,1-2H3;1-3H/t14-,15+,16+,17+,18+,19+;/m1./s1 |
| InChIKey | TWAJSIZTJKCZTL-GKBYRRLYSA-N |
| XLogP | 6.48 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.53 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |