C26H36 — CID 173485296
(8S,9S,10S,13R,14S)-16-benzylidene-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,14,15,17-tetradecahydrocyclopenta[a]phenanthrene (PubChem CID 173485296) has the molecular formula C26H36 and a molecular weight of 348.57 g/mol. Its IUPAC name is (8S,9S,10S,13R,14S)-16-benzylidene-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,14,15,17-tetradecahydrocyclopenta[a]phenanthrene.
| Compound Name | (8S,9S,10S,13R,14S)-16-benzylidene-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,14,15,17-tetradecahydrocyclopenta[a]phenanthrene |
|---|---|
| PubChem CID | 173485296 |
| Molecular Formula | C26H36 |
| Molecular Weight | 348.57 g/mol |
| Exact Mass | 348.28 |
| IUPAC Name | (8S,9S,10S,13R,14S)-16-benzylidene-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,14,15,17-tetradecahydrocyclopenta[a]phenanthrene |
| SMILES | C[C@]12CC[C@H]3[C@@H](CCC4CCCC[C@@]43C)[C@@H]1CC(=Cc1ccccc1)C2 |
| InChI | InChI=1S/C26H36/c1-25-15-13-23-22(12-11-21-10-6-7-14-26(21,23)2)24(25)17-20(18-25)16-19-8-4-3-5-9-19/h3-5,8-9,16,21-24H,6-7,10-15,17-18H2,1-2H3/t21?,22-,23+,24+,25-,26+/m1/s1 |
| InChIKey | PSUFVZFXGOVTOA-PGDLUIMUSA-N |
| XLogP | 7.50 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.57 |
| LogP ≤ 5 | 7.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |