C26H36 — CID 57242209
(8S,9R,10R,13S,14S)-6-benzylidene-10,13-dimethyl-1,2,3,4,5,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthrene (PubChem CID 57242209) has the molecular formula C26H36 and a molecular weight of 348.57 g/mol. Its IUPAC name is (8S,9R,10R,13S,14S)-6-benzylidene-10,13-dimethyl-1,2,3,4,5,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthrene.
| Compound Name | (8S,9R,10R,13S,14S)-6-benzylidene-10,13-dimethyl-1,2,3,4,5,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthrene |
|---|---|
| PubChem CID | 57242209 |
| Molecular Formula | C26H36 |
| Molecular Weight | 348.57 g/mol |
| Exact Mass | 348.28 |
| IUPAC Name | (8S,9R,10R,13S,14S)-6-benzylidene-10,13-dimethyl-1,2,3,4,5,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthrene |
| SMILES | C[C@@]12CCC[C@H]1[C@@H]1CC(=Cc3ccccc3)C3CCCC[C@]3(C)[C@@H]1CC2 |
| InChI | InChI=1S/C26H36/c1-25-14-8-12-23(25)21-18-20(17-19-9-4-3-5-10-19)22-11-6-7-15-26(22,2)24(21)13-16-25/h3-5,9-10,17,21-24H,6-8,11-16,18H2,1-2H3/t21-,22?,23-,24+,25-,26-/m0/s1 |
| InChIKey | NEFKBPVOKSGXST-HYPFAWLJSA-N |
| XLogP | 7.50 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.57 |
| LogP ≤ 5 | 7.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |