C28H40 — CID 123578864
(8S,9R,10S,13R,14S)-16-benzylidene-7,7,10,13-tetramethyl-2,3,4,5,6,8,9,11,12,14,15,17-dodecahydro-1H-cyclopenta[a]phenanthrene (PubChem CID 123578864) has the molecular formula C28H40 and a molecular weight of 376.63 g/mol. Its IUPAC name is (8S,9R,10S,13R,14S)-16-benzylidene-7,7,10,13-tetramethyl-2,3,4,5,6,8,9,11,12,14,15,17-dodecahydro-1H-cyclopenta[a]phenanthrene.
| Compound Name | (8S,9R,10S,13R,14S)-16-benzylidene-7,7,10,13-tetramethyl-2,3,4,5,6,8,9,11,12,14,15,17-dodecahydro-1H-cyclopenta[a]phenanthrene |
|---|---|
| PubChem CID | 123578864 |
| Molecular Formula | C28H40 |
| Molecular Weight | 376.63 g/mol |
| Exact Mass | 376.31 |
| IUPAC Name | (8S,9R,10S,13R,14S)-16-benzylidene-7,7,10,13-tetramethyl-2,3,4,5,6,8,9,11,12,14,15,17-dodecahydro-1H-cyclopenta[a]phenanthrene |
| SMILES | CC1(C)CC2CCCC[C@]2(C)[C@@H]2CC[C@]3(C)CC(=Cc4ccccc4)C[C@H]3[C@@H]21 |
| InChI | InChI=1S/C28H40/c1-26(2)19-22-12-8-9-14-28(22,4)23-13-15-27(3)18-21(17-24(27)25(23)26)16-20-10-6-5-7-11-20/h5-7,10-11,16,22-25H,8-9,12-15,17-19H2,1-4H3/t22?,23-,24+,25-,27-,28+/m1/s1 |
| InChIKey | HQIDRNLKPITCSE-LQYRZKFXSA-N |
| XLogP | 8.14 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.63 |
| LogP ≤ 5 | 8.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |