C26H33BrO — CID 124897207
(5R,8S,9R,10S,13S,14S,16E)-16-[(4-bromophenyl)methylidene]-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15-dodecahydro-1H-cyclopenta[a]phenanthren-17-one (PubChem CID 124897207) has the molecular formula C26H33BrO and a molecular weight of 441.45 g/mol. Its IUPAC name is (5R,8S,9R,10S,13S,14S,16E)-16-[(4-bromophenyl)methylidene]-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15-dodecahydro-1H-cyclopenta[a]phenanthren-17-one.
| Compound Name | (5R,8S,9R,10S,13S,14S,16E)-16-[(4-bromophenyl)methylidene]-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15-dodecahydro-1H-cyclopenta[a]phenanthren-17-one |
|---|---|
| PubChem CID | 124897207 |
| Molecular Formula | C26H33BrO |
| Molecular Weight | 441.45 g/mol |
| Exact Mass | 440.17 |
| IUPAC Name | (5R,8S,9R,10S,13S,14S,16E)-16-[(4-bromophenyl)methylidene]-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15-dodecahydro-1H-cyclopenta[a]phenanthren-17-one |
| SMILES | C[C@]12CCCC[C@@H]1CC[C@H]1[C@H]2CC[C@]2(C)C(=O)/C(=C/c3ccc(Br)cc3)C[C@@H]12 |
| InChI | InChI=1S/C26H33BrO/c1-25-13-4-3-5-19(25)8-11-21-22(25)12-14-26(2)23(21)16-18(24(26)28)15-17-6-9-20(27)10-7-17/h6-7,9-10,15,19,21-23H,3-5,8,11-14,16H2,1-2H3/b18-15+/t19-,21+,22-,23+,25+,26+/m1/s1 |
| InChIKey | CTGFFXZZHKKDLF-SSSHKRAFSA-N |
| XLogP | 7.44 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.45 |
| LogP ≤ 5 | 7.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|