C26H35NO3 — CID 163146580
4-[[(5R,8S,9S,10S,13R,14S)-10,13-dimethyl-17-oxo-2,3,4,5,6,7,8,9,11,12,14,15-dodecahydro-1H-cyclopenta[a]phenanthren-16-ylidene]methyl]-N-hydroxybenzeneamine oxide (PubChem CID 163146580) has the molecular formula C26H35NO3 and a molecular weight of 409.57 g/mol. Its IUPAC name is 4-[[(5R,8S,9S,10S,13R,14S)-10,13-dimethyl-17-oxo-2,3,4,5,6,7,8,9,11,12,14,15-dodecahydro-1H-cyclopenta[a]phenanthren-16-ylidene]methyl]-N-hydroxybenzeneamine oxide.
| Compound Name | 4-[[(5R,8S,9S,10S,13R,14S)-10,13-dimethyl-17-oxo-2,3,4,5,6,7,8,9,11,12,14,15-dodecahydro-1H-cyclopenta[a]phenanthren-16-ylidene]methyl]-N-hydroxybenzeneamine oxide |
|---|---|
| PubChem CID | 163146580 |
| Molecular Formula | C26H35NO3 |
| Molecular Weight | 409.57 g/mol |
| Exact Mass | 409.26 |
| IUPAC Name | 4-[[(5R,8S,9S,10S,13R,14S)-10,13-dimethyl-17-oxo-2,3,4,5,6,7,8,9,11,12,14,15-dodecahydro-1H-cyclopenta[a]phenanthren-16-ylidene]methyl]-N-hydroxybenzeneamine oxide |
| SMILES | C[C@]12CCCC[C@@H]1CC[C@H]1[C@@H]2CC[C@@]2(C)C(=O)C(=Cc3ccc([NH+]([O-])O)cc3)C[C@@H]12 |
| InChI | InChI=1S/C26H35NO3/c1-25-13-4-3-5-19(25)8-11-21-22(25)12-14-26(2)23(21)16-18(24(26)28)15-17-6-9-20(10-7-17)27(29)30/h6-7,9-10,15,19,21-23,27,29H,3-5,8,11-14,16H2,1-2H3/t19-,21+,22+,23+,25+,26-/m1/s1 |
| InChIKey | LVADYPQOWXTZKX-GQOXXRCZSA-N |
| XLogP | 5.09 |
| TPSA | 64.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.57 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|