C24H32OS — CID 22305477
(5R,8R,9S,10S,13S,14S,16Z)-10,13-dimethyl-16-(thiophen-2-ylmethylidene)-2,3,4,5,6,7,8,9,11,12,14,15-dodecahydro-1H-cyclopenta[a]phenanthren-17-one (PubChem CID 22305477) has the molecular formula C24H32OS and a molecular weight of 368.59 g/mol. Its IUPAC name is (5R,8R,9S,10S,13S,14S,16Z)-10,13-dimethyl-16-(thiophen-2-ylmethylidene)-2,3,4,5,6,7,8,9,11,12,14,15-dodecahydro-1H-cyclopenta[a]phenanthren-17-one.
| Compound Name | (5R,8R,9S,10S,13S,14S,16Z)-10,13-dimethyl-16-(thiophen-2-ylmethylidene)-2,3,4,5,6,7,8,9,11,12,14,15-dodecahydro-1H-cyclopenta[a]phenanthren-17-one |
|---|---|
| PubChem CID | 22305477 |
| Molecular Formula | C24H32OS |
| Molecular Weight | 368.59 g/mol |
| Exact Mass | 368.22 |
| IUPAC Name | (5R,8R,9S,10S,13S,14S,16Z)-10,13-dimethyl-16-(thiophen-2-ylmethylidene)-2,3,4,5,6,7,8,9,11,12,14,15-dodecahydro-1H-cyclopenta[a]phenanthren-17-one |
| SMILES | C[C@]12CCCC[C@@H]1CC[C@@H]1[C@@H]2CC[C@]2(C)C(=O)/C(=C\c3cccs3)C[C@@H]12 |
| InChI | InChI=1S/C24H32OS/c1-23-11-4-3-6-17(23)8-9-19-20(23)10-12-24(2)21(19)15-16(22(24)25)14-18-7-5-13-26-18/h5,7,13-14,17,19-21H,3-4,6,8-12,15H2,1-2H3/b16-14-/t17-,19-,20+,21+,23+,24+/m1/s1 |
| InChIKey | KEFQOADBHMAFFK-VADJHPBDSA-N |
| XLogP | 6.74 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.59 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|