C27H33F3O — CID 124916470
(5R,8S,9R,10R,13S,14R,16E)-10,13-dimethyl-16-[[4-(trifluoromethyl)phenyl]methylidene]-2,3,4,5,6,7,8,9,11,12,14,15-dodecahydro-1H-cyclopenta[a]phenanthren-17-one (PubChem CID 124916470) has the molecular formula C27H33F3O and a molecular weight of 430.55 g/mol. Its IUPAC name is (5R,8S,9R,10R,13S,14R,16E)-10,13-dimethyl-16-[[4-(trifluoromethyl)phenyl]methylidene]-2,3,4,5,6,7,8,9,11,12,14,15-dodecahydro-1H-cyclopenta[a]phenanthren-17-one.
| Compound Name | (5R,8S,9R,10R,13S,14R,16E)-10,13-dimethyl-16-[[4-(trifluoromethyl)phenyl]methylidene]-2,3,4,5,6,7,8,9,11,12,14,15-dodecahydro-1H-cyclopenta[a]phenanthren-17-one |
|---|---|
| PubChem CID | 124916470 |
| Molecular Formula | C27H33F3O |
| Molecular Weight | 430.55 g/mol |
| Exact Mass | 430.25 |
| IUPAC Name | (5R,8S,9R,10R,13S,14R,16E)-10,13-dimethyl-16-[[4-(trifluoromethyl)phenyl]methylidene]-2,3,4,5,6,7,8,9,11,12,14,15-dodecahydro-1H-cyclopenta[a]phenanthren-17-one |
| SMILES | C[C@@]12CCCC[C@@H]1CC[C@H]1[C@H]2CC[C@]2(C)C(=O)/C(=C/c3ccc(C(F)(F)F)cc3)C[C@H]12 |
| InChI | InChI=1S/C27H33F3O/c1-25-13-4-3-5-19(25)10-11-21-22(25)12-14-26(2)23(21)16-18(24(26)31)15-17-6-8-20(9-7-17)27(28,29)30/h6-9,15,19,21-23H,3-5,10-14,16H2,1-2H3/b18-15+/t19-,21+,22-,23-,25-,26+/m1/s1 |
| InChIKey | CMCWTYNIVZMUIH-NFTYERRWSA-N |
| XLogP | 7.70 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.55 |
| LogP ≤ 5 | 7.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|