C28H38O2 — CID 124903344
(5R,8S,9R,10S,13S,14R,16Z)-16-[(4-ethoxyphenyl)methylidene]-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15-dodecahydro-1H-cyclopenta[a]phenanthren-17-one (PubChem CID 124903344) has the molecular formula C28H38O2 and a molecular weight of 406.61 g/mol. Its IUPAC name is (5R,8S,9R,10S,13S,14R,16Z)-16-[(4-ethoxyphenyl)methylidene]-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15-dodecahydro-1H-cyclopenta[a]phenanthren-17-one.
| Compound Name | (5R,8S,9R,10S,13S,14R,16Z)-16-[(4-ethoxyphenyl)methylidene]-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15-dodecahydro-1H-cyclopenta[a]phenanthren-17-one |
|---|---|
| PubChem CID | 124903344 |
| Molecular Formula | C28H38O2 |
| Molecular Weight | 406.61 g/mol |
| Exact Mass | 406.29 |
| IUPAC Name | (5R,8S,9R,10S,13S,14R,16Z)-16-[(4-ethoxyphenyl)methylidene]-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15-dodecahydro-1H-cyclopenta[a]phenanthren-17-one |
| SMILES | CCOc1ccc(/C=C2/C[C@@H]3[C@H]4CC[C@H]5CCCC[C@]5(C)[C@@H]4CC[C@]3(C)C2=O)cc1 |
| InChI | InChI=1S/C28H38O2/c1-4-30-22-11-8-19(9-12-22)17-20-18-25-23-13-10-21-7-5-6-15-27(21,2)24(23)14-16-28(25,3)26(20)29/h8-9,11-12,17,21,23-25H,4-7,10,13-16,18H2,1-3H3/b20-17-/t21-,23+,24-,25-,27+,28+/m1/s1 |
| InChIKey | GQZPOAUVKZAMQR-JBWAWTCQSA-N |
| XLogP | 7.08 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.61 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|