C19H32FNO2 — CID 91118044
(8R,9R,10S,13S,14S)-17-amino-17-fluoro-10,13-dimethyl-2,3,4,5,6,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthrene-7,7-diol (PubChem CID 91118044) has the molecular formula C19H32FNO2 and a molecular weight of 325.47 g/mol. Its IUPAC name is (8R,9R,10S,13S,14S)-17-amino-17-fluoro-10,13-dimethyl-2,3,4,5,6,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthrene-7,7-diol.
| Compound Name | (8R,9R,10S,13S,14S)-17-amino-17-fluoro-10,13-dimethyl-2,3,4,5,6,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthrene-7,7-diol |
|---|---|
| PubChem CID | 91118044 |
| Molecular Formula | C19H32FNO2 |
| Molecular Weight | 325.47 g/mol |
| Exact Mass | 325.24 |
| IUPAC Name | (8R,9R,10S,13S,14S)-17-amino-17-fluoro-10,13-dimethyl-2,3,4,5,6,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthrene-7,7-diol |
| SMILES | C[C@]12CCCCC1CC(O)(O)[C@@H]1[C@H]2CC[C@@]2(C)[C@H]1CCC2(N)F |
| InChI | InChI=1S/C19H32FNO2/c1-16-8-4-3-5-12(16)11-18(22,23)15-13(16)6-9-17(2)14(15)7-10-19(17,20)21/h12-15,22-23H,3-11,21H2,1-2H3/t12?,13-,14+,15-,16+,17+,19?/m1/s1 |
| InChIKey | ZVWRYYPLCXPVQF-YRCFIZJFSA-N |
| XLogP | 3.33 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.47 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|