C25H36O — CID 11867647
(5R,8R,9S,10S,13R,14R,17R)-10,13-dimethyl-17-phenyl-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-17-ol (PubChem CID 11867647) has the molecular formula C25H36O and a molecular weight of 352.56 g/mol. Its IUPAC name is (5R,8R,9S,10S,13R,14R,17R)-10,13-dimethyl-17-phenyl-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-17-ol.
| Compound Name | (5R,8R,9S,10S,13R,14R,17R)-10,13-dimethyl-17-phenyl-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-17-ol |
|---|---|
| PubChem CID | 11867647 |
| Molecular Formula | C25H36O |
| Molecular Weight | 352.56 g/mol |
| Exact Mass | 352.28 |
| IUPAC Name | (5R,8R,9S,10S,13R,14R,17R)-10,13-dimethyl-17-phenyl-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-17-ol |
| SMILES | C[C@]12CCCC[C@@H]1CC[C@H]1[C@H]3CC[C@](O)(c4ccccc4)[C@]3(C)CC[C@@H]12 |
| InChI | InChI=1S/C25H36O/c1-23-15-7-6-8-18(23)11-12-20-21(23)13-16-24(2)22(20)14-17-25(24,26)19-9-4-3-5-10-19/h3-5,9-10,18,20-22,26H,6-8,11-17H2,1-2H3/t18-,20-,21+,22-,23+,24-,25+/m1/s1 |
| InChIKey | GUFISKMWHBUYOH-BUPZYREKSA-N |
| XLogP | 6.31 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.56 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |