C26H38O — CID 57002198
[(8R,9R,10S,13S,14S)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]-phenylmethanol (PubChem CID 57002198) has the molecular formula C26H38O and a molecular weight of 366.59 g/mol. Its IUPAC name is [(8R,9R,10S,13S,14S)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]-phenylmethanol.
| Compound Name | [(8R,9R,10S,13S,14S)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]-phenylmethanol |
|---|---|
| PubChem CID | 57002198 |
| Molecular Formula | C26H38O |
| Molecular Weight | 366.59 g/mol |
| Exact Mass | 366.29 |
| IUPAC Name | [(8R,9R,10S,13S,14S)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]-phenylmethanol |
| SMILES | C[C@]12CCCCC1CC[C@@H]1[C@H]2CC[C@]2(C)C(C(O)c3ccccc3)CC[C@@H]12 |
| InChI | InChI=1S/C26H38O/c1-25-16-7-6-10-19(25)11-12-20-21-13-14-23(26(21,2)17-15-22(20)25)24(27)18-8-4-3-5-9-18/h3-5,8-9,19-24,27H,6-7,10-17H2,1-2H3/t19?,20-,21-,22+,23?,24?,25-,26-/m0/s1 |
| InChIKey | UGLLWAIYMPTXBR-JOSNYWGQSA-N |
| XLogP | 6.77 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.59 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |