C21H34O3 — CID 146035865
(3S,4R)-3-hydroxy-4,10,13-trimethyl-1,2,3,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthrene-4-carboxylic acid (PubChem CID 146035865) has the molecular formula C21H34O3 and a molecular weight of 334.50 g/mol. Its IUPAC name is (3S,4R)-3-hydroxy-4,10,13-trimethyl-1,2,3,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthrene-4-carboxylic acid.
| Compound Name | (3S,4R)-3-hydroxy-4,10,13-trimethyl-1,2,3,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthrene-4-carboxylic acid |
|---|---|
| PubChem CID | 146035865 |
| Molecular Formula | C21H34O3 |
| Molecular Weight | 334.50 g/mol |
| Exact Mass | 334.25 |
| IUPAC Name | (3S,4R)-3-hydroxy-4,10,13-trimethyl-1,2,3,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthrene-4-carboxylic acid |
| SMILES | CC12CCCC1C1CCC3C(C)(CC[C@H](O)[C@]3(C)C(=O)O)C1CC2 |
| InChI | InChI=1S/C21H34O3/c1-19-10-4-5-14(19)13-6-7-16-20(2,15(13)8-11-19)12-9-17(22)21(16,3)18(23)24/h13-17,22H,4-12H2,1-3H3,(H,23,24)/t13?,14?,15?,16?,17-,19?,20?,21+/m0/s1 |
| InChIKey | DWKHAHUWMWAIAP-UVESEQQFSA-N |
| XLogP | 4.48 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.50 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |