C23H35NO — CID 176525469
N-[(8S,9S,10S,13S,14S)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-1-yl]buta-2,3-dienamide (PubChem CID 176525469) has the molecular formula C23H35NO and a molecular weight of 341.54 g/mol. Its IUPAC name is N-[(8S,9S,10S,13S,14S)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-1-yl]buta-2,3-dienamide.
| Compound Name | N-[(8S,9S,10S,13S,14S)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-1-yl]buta-2,3-dienamide |
|---|---|
| PubChem CID | 176525469 |
| Molecular Formula | C23H35NO |
| Molecular Weight | 341.54 g/mol |
| Exact Mass | 341.27 |
| IUPAC Name | N-[(8S,9S,10S,13S,14S)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-1-yl]buta-2,3-dienamide |
| SMILES | C=C=CC(=O)NC1CCCC2CC[C@H]3[C@@H]4CCC[C@@]4(C)CC[C@@H]3[C@]21C |
| InChI | InChI=1S/C23H35NO/c1-4-7-21(25)24-20-10-5-8-16-11-12-17-18-9-6-14-22(18,2)15-13-19(17)23(16,20)3/h7,16-20H,1,5-6,8-15H2,2-3H3,(H,24,25)/t16?,17-,18-,19-,20?,22-,23-/m0/s1 |
| InChIKey | UCLNBNWXWBUJRH-SXUIBZKYSA-N |
| XLogP | 5.25 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.54 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|