C22H35NO3 — CID 171358082
3-[[(3R,5R,8S,9S,10S,13S,14S)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl]amino]-3-oxopropanoic acid (PubChem CID 171358082) has the molecular formula C22H35NO3 and a molecular weight of 361.53 g/mol. Its IUPAC name is 3-[[(3R,5R,8S,9S,10S,13S,14S)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl]amino]-3-oxopropanoic acid.
| Compound Name | 3-[[(3R,5R,8S,9S,10S,13S,14S)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl]amino]-3-oxopropanoic acid |
|---|---|
| PubChem CID | 171358082 |
| Molecular Formula | C22H35NO3 |
| Molecular Weight | 361.53 g/mol |
| Exact Mass | 361.26 |
| IUPAC Name | 3-[[(3R,5R,8S,9S,10S,13S,14S)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl]amino]-3-oxopropanoic acid |
| SMILES | C[C@@]12CCC[C@H]1[C@@H]1CC[C@@H]3C[C@H](NC(=O)CC(=O)O)CC[C@]3(C)[C@H]1CC2 |
| InChI | InChI=1S/C22H35NO3/c1-21-9-3-4-17(21)16-6-5-14-12-15(23-19(24)13-20(25)26)7-11-22(14,2)18(16)8-10-21/h14-18H,3-13H2,1-2H3,(H,23,24)(H,25,26)/t14-,15-,16+,17+,18+,21+,22+/m1/s1 |
| InChIKey | LNUCVTUWNZTMLA-DMNIQJBYSA-N |
| XLogP | 4.38 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.53 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|