C22H35NO3 — CID 118905581
2-oxo-2-[[(10S,13R,14S,17S)-10,13,17-trimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl]amino]acetic acid (PubChem CID 118905581) has the molecular formula C22H35NO3 and a molecular weight of 361.53 g/mol. Its IUPAC name is 2-oxo-2-[[(10S,13R,14S,17S)-10,13,17-trimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl]amino]acetic acid.
| Compound Name | 2-oxo-2-[[(10S,13R,14S,17S)-10,13,17-trimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl]amino]acetic acid |
|---|---|
| PubChem CID | 118905581 |
| Molecular Formula | C22H35NO3 |
| Molecular Weight | 361.53 g/mol |
| Exact Mass | 361.26 |
| IUPAC Name | 2-oxo-2-[[(10S,13R,14S,17S)-10,13,17-trimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl]amino]acetic acid |
| SMILES | C[C@H]1CC[C@H]2C3CCC4CC(NC(=O)C(=O)O)CC[C@]4(C)C3CC[C@]12C |
| InChI | InChI=1S/C22H35NO3/c1-13-4-7-17-16-6-5-14-12-15(23-19(24)20(25)26)8-10-22(14,3)18(16)9-11-21(13,17)2/h13-18H,4-12H2,1-3H3,(H,23,24)(H,25,26)/t13-,14?,15?,16?,17-,18?,21+,22-/m0/s1 |
| InChIKey | ZHKAFJLZLYJTSB-BMZQGRPHSA-N |
| XLogP | 4.23 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.53 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|