C24H39NO3 — CID 130339113
ethyl 2-oxo-2-[[(3R,5R,8S,9S,10S,13R,14S,17S)-10,13,17-trimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl]amino]acetate (PubChem CID 130339113) has the molecular formula C24H39NO3 and a molecular weight of 389.58 g/mol. Its IUPAC name is ethyl 2-oxo-2-[[(3R,5R,8S,9S,10S,13R,14S,17S)-10,13,17-trimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl]amino]acetate.
| Compound Name | ethyl 2-oxo-2-[[(3R,5R,8S,9S,10S,13R,14S,17S)-10,13,17-trimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl]amino]acetate |
|---|---|
| PubChem CID | 130339113 |
| Molecular Formula | C24H39NO3 |
| Molecular Weight | 389.58 g/mol |
| Exact Mass | 389.29 |
| IUPAC Name | ethyl 2-oxo-2-[[(3R,5R,8S,9S,10S,13R,14S,17S)-10,13,17-trimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl]amino]acetate |
| SMILES | CCOC(=O)C(=O)N[C@@H]1CC[C@@]2(C)[C@H](CC[C@@H]3[C@@H]2CC[C@]2(C)[C@@H](C)CC[C@@H]32)C1 |
| InChI | InChI=1S/C24H39NO3/c1-5-28-22(27)21(26)25-17-10-12-24(4)16(14-17)7-8-18-19-9-6-15(2)23(19,3)13-11-20(18)24/h15-20H,5-14H2,1-4H3,(H,25,26)/t15-,16+,17+,18-,19-,20-,23+,24-/m0/s1 |
| InChIKey | VAFKOQGNBNKGBL-YQTOSUGYSA-N |
| XLogP | 4.71 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.58 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|