C26H41NO2 — CID 170239316
ethyl 2-[(5S,8R,9S,10S,13S,14S,17R)-10,13-dimethyl-17-prop-1-en-2-yl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl]-2-iminoacetate (PubChem CID 170239316) has the molecular formula C26H41NO2 and a molecular weight of 399.62 g/mol. Its IUPAC name is ethyl 2-[(5S,8R,9S,10S,13S,14S,17R)-10,13-dimethyl-17-prop-1-en-2-yl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl]-2-iminoacetate.
| Compound Name | ethyl 2-[(5S,8R,9S,10S,13S,14S,17R)-10,13-dimethyl-17-prop-1-en-2-yl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl]-2-iminoacetate |
|---|---|
| PubChem CID | 170239316 |
| Molecular Formula | C26H41NO2 |
| Molecular Weight | 399.62 g/mol |
| Exact Mass | 399.31 |
| IUPAC Name | ethyl 2-[(5S,8R,9S,10S,13S,14S,17R)-10,13-dimethyl-17-prop-1-en-2-yl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl]-2-iminoacetate |
| SMILES | [H]/N=C(\C(=O)OCC)C1CC[C@@]2(C)[C@@H](CC[C@@H]3[C@@H]2CC[C@]2(C)[C@@H](C(=C)C)CC[C@@H]32)C1 |
| InChI | InChI=1S/C26H41NO2/c1-6-29-24(28)23(27)17-11-13-25(4)18(15-17)7-8-19-21-10-9-20(16(2)3)26(21,5)14-12-22(19)25/h17-22,27H,2,6-15H2,1,3-5H3/b27-23-/t17?,18-,19-,20+,21-,22-,25-,26+/m0/s1 |
| InChIKey | DIBPVVISSQZVAU-NJHZCPBHSA-N |
| XLogP | 6.42 |
| TPSA | 50.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.62 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|