C25H42O — CID 170228827
(3S,5R,8R,9S,10S,13S,14S,17R)-3-(methoxymethyl)-3,10,13-trimethyl-17-prop-1-en-2-yl-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthrene (PubChem CID 170228827) has the molecular formula C25H42O and a molecular weight of 358.61 g/mol. Its IUPAC name is (3S,5R,8R,9S,10S,13S,14S,17R)-3-(methoxymethyl)-3,10,13-trimethyl-17-prop-1-en-2-yl-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthrene.
| Compound Name | (3S,5R,8R,9S,10S,13S,14S,17R)-3-(methoxymethyl)-3,10,13-trimethyl-17-prop-1-en-2-yl-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthrene |
|---|---|
| PubChem CID | 170228827 |
| Molecular Formula | C25H42O |
| Molecular Weight | 358.61 g/mol |
| Exact Mass | 358.32 |
| IUPAC Name | (3S,5R,8R,9S,10S,13S,14S,17R)-3-(methoxymethyl)-3,10,13-trimethyl-17-prop-1-en-2-yl-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthrene |
| SMILES | C=C(C)[C@H]1CC[C@H]2[C@@H]3CC[C@@H]4C[C@@](C)(COC)CC[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C25H42O/c1-17(2)20-9-10-21-19-8-7-18-15-23(3,16-26-6)13-14-24(18,4)22(19)11-12-25(20,21)5/h18-22H,1,7-16H2,2-6H3/t18-,19+,20-,21+,22+,23+,24+,25-/m1/s1 |
| InChIKey | ZJADLRFRGRGHSE-HOJFQYKESA-N |
| XLogP | 6.87 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.61 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|