C25H34O — CID 154246701
(5S,8S,9S,10R,13S,14S)-10,13-dimethyl-3-phenoxy-4,5,6,7,8,9,11,12,14,15,16,17-dodecahydro-3H-cyclopenta[a]phenanthrene (PubChem CID 154246701) has the molecular formula C25H34O and a molecular weight of 350.55 g/mol. Its IUPAC name is (5S,8S,9S,10R,13S,14S)-10,13-dimethyl-3-phenoxy-4,5,6,7,8,9,11,12,14,15,16,17-dodecahydro-3H-cyclopenta[a]phenanthrene.
| Compound Name | (5S,8S,9S,10R,13S,14S)-10,13-dimethyl-3-phenoxy-4,5,6,7,8,9,11,12,14,15,16,17-dodecahydro-3H-cyclopenta[a]phenanthrene |
|---|---|
| PubChem CID | 154246701 |
| Molecular Formula | C25H34O |
| Molecular Weight | 350.55 g/mol |
| Exact Mass | 350.26 |
| IUPAC Name | (5S,8S,9S,10R,13S,14S)-10,13-dimethyl-3-phenoxy-4,5,6,7,8,9,11,12,14,15,16,17-dodecahydro-3H-cyclopenta[a]phenanthrene |
| SMILES | C[C@@]12CCC[C@H]1[C@@H]1CC[C@H]3CC(Oc4ccccc4)C=C[C@]3(C)[C@H]1CC2 |
| InChI | InChI=1S/C25H34O/c1-24-14-6-9-22(24)21-11-10-18-17-20(26-19-7-4-3-5-8-19)12-16-25(18,2)23(21)13-15-24/h3-5,7-8,12,16,18,20-23H,6,9-11,13-15,17H2,1-2H3/t18-,20?,21-,22-,23-,24-,25-/m0/s1 |
| InChIKey | ABTKOZMMWBKFHK-KBCLHDOESA-N |
| XLogP | 6.64 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.55 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|