C26H38O — CID 163042279
(3S,5R,8S,9R,10S,13S,14S)-10,13-dimethyl-3-phenylmethoxy-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthrene (PubChem CID 163042279) has the molecular formula C26H38O and a molecular weight of 366.59 g/mol. Its IUPAC name is (3S,5R,8S,9R,10S,13S,14S)-10,13-dimethyl-3-phenylmethoxy-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthrene.
| Compound Name | (3S,5R,8S,9R,10S,13S,14S)-10,13-dimethyl-3-phenylmethoxy-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthrene |
|---|---|
| PubChem CID | 163042279 |
| Molecular Formula | C26H38O |
| Molecular Weight | 366.59 g/mol |
| Exact Mass | 366.29 |
| IUPAC Name | (3S,5R,8S,9R,10S,13S,14S)-10,13-dimethyl-3-phenylmethoxy-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthrene |
| SMILES | C[C@@]12CCC[C@H]1[C@@H]1CC[C@@H]3C[C@@H](OCc4ccccc4)CC[C@]3(C)[C@@H]1CC2 |
| InChI | InChI=1S/C26H38O/c1-25-14-6-9-23(25)22-11-10-20-17-21(27-18-19-7-4-3-5-8-19)12-16-26(20,2)24(22)13-15-25/h3-5,7-8,20-24H,6,9-18H2,1-2H3/t20-,21+,22+,23+,24-,25+,26+/m1/s1 |
| InChIKey | XVAQUNQDQASSEH-DAEGYCLPSA-N |
| XLogP | 7.00 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.59 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |