C22H37BO2 — CID 6427816
(4R)-4-[(5R,10S,13S)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-methyl-1,3,2-dioxaborolane (PubChem CID 6427816) has the molecular formula C22H37BO2 and a molecular weight of 344.35 g/mol. Its IUPAC name is (4R)-4-[(5R,10S,13S)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-methyl-1,3,2-dioxaborolane.
| Compound Name | (4R)-4-[(5R,10S,13S)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-methyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 6427816 |
| Molecular Formula | C22H37BO2 |
| Molecular Weight | 344.35 g/mol |
| Exact Mass | 344.29 |
| IUPAC Name | (4R)-4-[(5R,10S,13S)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-methyl-1,3,2-dioxaborolane |
| SMILES | CB1OC[C@@H](C2CCC3C4CC[C@H]5CCCC[C@]5(C)C4CC[C@@]32C)O1 |
| InChI | InChI=1S/C22H37BO2/c1-21-12-5-4-6-15(21)7-8-16-17-9-10-19(20-14-24-23(3)25-20)22(17,2)13-11-18(16)21/h15-20H,4-14H2,1-3H3/t15-,16?,17?,18?,19?,20+,21+,22+/m1/s1 |
| InChIKey | QXLQOGXVJHVLBW-NOIGGQGKSA-N |
| XLogP | 5.57 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.35 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|