About 11-methylpentacyclo[8.8.0.02,7.05,7.011,16]octadecane
11-methylpentacyclo[8.8.0.02,7.05,7.011,16]octadecane (PubChem CID 172568187) has the molecular formula C19H30
and a molecular weight of 258.45 g/mol. Its IUPAC name is 11-methylpentacyclo[8.8.0.02,7.05,7.011,16]octadecane.
Analyze 11-methylpentacyclo[8.8.0.02,7.05,7.011,16]octadecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 11-methylpentacyclo[8.8.0.02,7.05,7.011,16]octadecane?
The IUPAC name of 11-methylpentacyclo[8.8.0.02,7.05,7.011,16]octadecane (CID 172568187) is 11-methylpentacyclo[8.8.0.02,7.05,7.011,16]octadecane.
What is the SMILES notation for 11-methylpentacyclo[8.8.0.02,7.05,7.011,16]octadecane?
The canonical SMILES for 11-methylpentacyclo[8.8.0.02,7.05,7.011,16]octadecane is CC12CCCCC1CCC1C2CCC23CC2CCC13.
What is the InChIKey of 11-methylpentacyclo[8.8.0.02,7.05,7.011,16]octadecane?
The InChIKey is JEKYJZSFDSKKKA-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H30/c1-18-10-3-2-4-13(18)5-7-15-16(18)9-11-19-12-14(19)6-8-17(15)19/h13-17H,2-12H2,1H3.
What are the key properties of 11-methylpentacyclo[8.8.0.02,7.05,7.011,16]octadecane?
11-methylpentacyclo[8.8.0.02,7.05,7.011,16]octadecane has a molecular weight of 258.45 g/mol, XLogP of 5.42, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 11-methylpentacyclo[8.8.0.02,7.05,7.011,16]octadecane is sourced from PubChem (CID 172568187), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).