C21H35NO — CID 70066274
(8R,9S,10S,13S,14S)-13-ethyl-10-methyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthrene-17-carboxamide (PubChem CID 70066274) has the molecular formula C21H35NO and a molecular weight of 317.52 g/mol. Its IUPAC name is (8R,9S,10S,13S,14S)-13-ethyl-10-methyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthrene-17-carboxamide.
| Compound Name | (8R,9S,10S,13S,14S)-13-ethyl-10-methyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthrene-17-carboxamide |
|---|---|
| PubChem CID | 70066274 |
| Molecular Formula | C21H35NO |
| Molecular Weight | 317.52 g/mol |
| Exact Mass | 317.27 |
| IUPAC Name | (8R,9S,10S,13S,14S)-13-ethyl-10-methyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthrene-17-carboxamide |
| SMILES | CC[C@]12CC[C@H]3[C@@H](CCC4CCCC[C@@]43C)[C@@H]1CCC2C(N)=O |
| InChI | InChI=1S/C21H35NO/c1-3-21-13-11-16-15(17(21)9-10-18(21)19(22)23)8-7-14-6-4-5-12-20(14,16)2/h14-18H,3-13H2,1-2H3,(H2,22,23)/t14?,15-,16+,17+,18?,20+,21+/m1/s1 |
| InChIKey | ZUKHUWIKHCJEON-YGGKNEHPSA-N |
| XLogP | 4.91 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.52 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |