C28H48O3Si — CID 88800864
(8S,9R,10S,13S,14S)-1,4,13,17-tetramethyl-3-oxo-17-triethylsilyloxy-2,4,5,6,7,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthrene-10-carbaldehyde (PubChem CID 88800864) has the molecular formula C28H48O3Si and a molecular weight of 460.78 g/mol. Its IUPAC name is (8S,9R,10S,13S,14S)-1,4,13,17-tetramethyl-3-oxo-17-triethylsilyloxy-2,4,5,6,7,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthrene-10-carbaldehyde.
| Compound Name | (8S,9R,10S,13S,14S)-1,4,13,17-tetramethyl-3-oxo-17-triethylsilyloxy-2,4,5,6,7,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthrene-10-carbaldehyde |
|---|---|
| PubChem CID | 88800864 |
| Molecular Formula | C28H48O3Si |
| Molecular Weight | 460.78 g/mol |
| Exact Mass | 460.34 |
| IUPAC Name | (8S,9R,10S,13S,14S)-1,4,13,17-tetramethyl-3-oxo-17-triethylsilyloxy-2,4,5,6,7,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthrene-10-carbaldehyde |
| SMILES | CC[Si](CC)(CC)OC1(C)CC[C@H]2[C@@H]3CCC4C(C)C(=O)CC(C)[C@]4(C=O)[C@@H]3CC[C@@]21C |
| InChI | InChI=1S/C28H48O3Si/c1-8-32(9-2,10-3)31-27(7)16-14-23-21-11-12-22-20(5)25(30)17-19(4)28(22,18-29)24(21)13-15-26(23,27)6/h18-24H,8-17H2,1-7H3/t19?,20?,21-,22?,23-,24+,26-,27?,28-/m0/s1 |
| InChIKey | SCWLHEQNEDVMCZ-XPENSRBJSA-N |
| XLogP | 7.05 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.78 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|