C25H36O4 — CID 88813024
[(1S,6S,8S,9S,10S,13S,14S,17S)-10-formyl-1,6,13,17-tetramethyl-3-oxo-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-yl] propanoate (PubChem CID 88813024) has the molecular formula C25H36O4 and a molecular weight of 400.56 g/mol. Its IUPAC name is [(1S,6S,8S,9S,10S,13S,14S,17S)-10-formyl-1,6,13,17-tetramethyl-3-oxo-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-yl] propanoate.
| Compound Name | [(1S,6S,8S,9S,10S,13S,14S,17S)-10-formyl-1,6,13,17-tetramethyl-3-oxo-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-yl] propanoate |
|---|---|
| PubChem CID | 88813024 |
| Molecular Formula | C25H36O4 |
| Molecular Weight | 400.56 g/mol |
| Exact Mass | 400.26 |
| IUPAC Name | [(1S,6S,8S,9S,10S,13S,14S,17S)-10-formyl-1,6,13,17-tetramethyl-3-oxo-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-yl] propanoate |
| SMILES | CCC(=O)O[C@@]1(C)CC[C@H]2[C@@H]3C[C@H](C)C4=CC(=O)C[C@H](C)[C@]4(C=O)[C@H]3CC[C@@]21C |
| InChI | InChI=1S/C25H36O4/c1-6-22(28)29-24(5)10-8-19-18-11-15(2)21-13-17(27)12-16(3)25(21,14-26)20(18)7-9-23(19,24)4/h13-16,18-20H,6-12H2,1-5H3/t15-,16-,18-,19-,20-,23-,24-,25+/m0/s1 |
| InChIKey | CVJUMLWNSQPOAB-XJJIQGCNSA-N |
| XLogP | 4.90 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.56 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|