C23H34O3S — CID 154975104
[(7R,17S)-10,13,17-trimethyl-3-oxo-7-sulfanyl-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-yl] propanoate (PubChem CID 154975104) has the molecular formula C23H34O3S and a molecular weight of 390.59 g/mol. Its IUPAC name is [(7R,17S)-10,13,17-trimethyl-3-oxo-7-sulfanyl-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-yl] propanoate.
| Compound Name | [(7R,17S)-10,13,17-trimethyl-3-oxo-7-sulfanyl-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-yl] propanoate |
|---|---|
| PubChem CID | 154975104 |
| Molecular Formula | C23H34O3S |
| Molecular Weight | 390.59 g/mol |
| Exact Mass | 390.22 |
| IUPAC Name | [(7R,17S)-10,13,17-trimethyl-3-oxo-7-sulfanyl-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-yl] propanoate |
| SMILES | CCC(=O)O[C@@]1(C)CCC2C3C(S)CC4=CC(=O)CCC4(C)C3CCC21C |
| InChI | InChI=1S/C23H34O3S/c1-5-19(25)26-23(4)11-8-17-20-16(7-10-22(17,23)3)21(2)9-6-15(24)12-14(21)13-18(20)27/h12,16-18,20,27H,5-11,13H2,1-4H3/t16?,17?,18?,20?,21?,22?,23-/m0/s1 |
| InChIKey | NWFPPRPNNFXOTN-NAMLDHCASA-N |
| XLogP | 5.14 |
| TPSA | 43.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.59 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|