C23H31NO3 — CID 67781186
[(7R,8R,9S,10R,13S,14S,17S)-7-cyano-10,13,17-trimethyl-3-oxo-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-yl] acetate (PubChem CID 67781186) has the molecular formula C23H31NO3 and a molecular weight of 369.51 g/mol. Its IUPAC name is [(7R,8R,9S,10R,13S,14S,17S)-7-cyano-10,13,17-trimethyl-3-oxo-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-yl] acetate.
| Compound Name | [(7R,8R,9S,10R,13S,14S,17S)-7-cyano-10,13,17-trimethyl-3-oxo-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-yl] acetate |
|---|---|
| PubChem CID | 67781186 |
| Molecular Formula | C23H31NO3 |
| Molecular Weight | 369.51 g/mol |
| Exact Mass | 369.23 |
| IUPAC Name | [(7R,8R,9S,10R,13S,14S,17S)-7-cyano-10,13,17-trimethyl-3-oxo-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-yl] acetate |
| SMILES | CC(=O)O[C@@]1(C)CC[C@H]2[C@@H]3[C@H](C#N)CC4=CC(=O)CC[C@]4(C)[C@H]3CC[C@@]21C |
| InChI | InChI=1S/C23H31NO3/c1-14(25)27-23(4)10-7-19-20-15(13-24)11-16-12-17(26)5-8-21(16,2)18(20)6-9-22(19,23)3/h12,15,18-20H,5-11H2,1-4H3/t15-,18-,19-,20+,21-,22-,23-/m0/s1 |
| InChIKey | JTVMTXKLUAHKAV-BESNNWJDSA-N |
| XLogP | 4.59 |
| TPSA | 67.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.51 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |