C23H32O3 — CID 12951781
[(8R,9S,10R,13S,14S,17S)-10,13,17-trimethyl-6-methylidene-3-oxo-1,2,7,8,9,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-17-yl] acetate (PubChem CID 12951781) has the molecular formula C23H32O3 and a molecular weight of 356.51 g/mol. Its IUPAC name is [(8R,9S,10R,13S,14S,17S)-10,13,17-trimethyl-6-methylidene-3-oxo-1,2,7,8,9,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-17-yl] acetate.
| Compound Name | [(8R,9S,10R,13S,14S,17S)-10,13,17-trimethyl-6-methylidene-3-oxo-1,2,7,8,9,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-17-yl] acetate |
|---|---|
| PubChem CID | 12951781 |
| Molecular Formula | C23H32O3 |
| Molecular Weight | 356.51 g/mol |
| Exact Mass | 356.24 |
| IUPAC Name | [(8R,9S,10R,13S,14S,17S)-10,13,17-trimethyl-6-methylidene-3-oxo-1,2,7,8,9,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-17-yl] acetate |
| SMILES | C=C1C[C@@H]2[C@H](CC[C@@]3(C)[C@H]2CC[C@]3(C)OC(C)=O)[C@@]2(C)CCC(=O)C=C12 |
| InChI | InChI=1S/C23H32O3/c1-14-12-17-18(21(3)9-6-16(25)13-20(14)21)7-10-22(4)19(17)8-11-23(22,5)26-15(2)24/h13,17-19H,1,6-12H2,2-5H3/t17-,18+,19+,21-,22+,23+/m1/s1 |
| InChIKey | MSMOOQPCSVHKLK-DEDMPRLZSA-N |
| XLogP | 5.01 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.51 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |