C27H32FNO2 — CID 91050133
(8R,9R,10R,13S,14S)-17-(4-fluorophenyl)-10,13-dimethyl-6-methylidene-3-oxo-1,2,7,8,9,11,12,14,15,16-decahydrocyclopenta[a]phenanthrene-17-carboxamide (PubChem CID 91050133) has the molecular formula C27H32FNO2 and a molecular weight of 421.56 g/mol. Its IUPAC name is (8R,9R,10R,13S,14S)-17-(4-fluorophenyl)-10,13-dimethyl-6-methylidene-3-oxo-1,2,7,8,9,11,12,14,15,16-decahydrocyclopenta[a]phenanthrene-17-carboxamide.
| Compound Name | (8R,9R,10R,13S,14S)-17-(4-fluorophenyl)-10,13-dimethyl-6-methylidene-3-oxo-1,2,7,8,9,11,12,14,15,16-decahydrocyclopenta[a]phenanthrene-17-carboxamide |
|---|---|
| PubChem CID | 91050133 |
| Molecular Formula | C27H32FNO2 |
| Molecular Weight | 421.56 g/mol |
| Exact Mass | 421.24 |
| IUPAC Name | (8R,9R,10R,13S,14S)-17-(4-fluorophenyl)-10,13-dimethyl-6-methylidene-3-oxo-1,2,7,8,9,11,12,14,15,16-decahydrocyclopenta[a]phenanthrene-17-carboxamide |
| SMILES | C=C1C[C@@H]2[C@@H](CC[C@@]3(C)[C@H]2CCC3(C(N)=O)c2ccc(F)cc2)[C@@]2(C)CCC(=O)C=C12 |
| InChI | InChI=1S/C27H32FNO2/c1-16-14-20-21(25(2)11-8-19(30)15-23(16)25)9-12-26(3)22(20)10-13-27(26,24(29)31)17-4-6-18(28)7-5-17/h4-7,15,20-22H,1,8-14H2,2-3H3,(H2,29,31)/t20-,21-,22+,25-,26+,27?/m1/s1 |
| InChIKey | CNMJXEYGKDVERR-YQJFTHBMSA-N |
| XLogP | 5.25 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.56 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |