C22H27NO6 — CID 70537707
[(8R,9S,10R,13S,14S,17R)-17-acetyl-10,13-dimethyl-6-methylidene-2,3-dioxo-7,8,9,11,12,14,15,16-octahydro-1H-cyclopenta[a]phenanthren-17-yl] nitrate (PubChem CID 70537707) has the molecular formula C22H27NO6 and a molecular weight of 401.46 g/mol. Its IUPAC name is [(8R,9S,10R,13S,14S,17R)-17-acetyl-10,13-dimethyl-6-methylidene-2,3-dioxo-7,8,9,11,12,14,15,16-octahydro-1H-cyclopenta[a]phenanthren-17-yl] nitrate.
| Compound Name | [(8R,9S,10R,13S,14S,17R)-17-acetyl-10,13-dimethyl-6-methylidene-2,3-dioxo-7,8,9,11,12,14,15,16-octahydro-1H-cyclopenta[a]phenanthren-17-yl] nitrate |
|---|---|
| PubChem CID | 70537707 |
| Molecular Formula | C22H27NO6 |
| Molecular Weight | 401.46 g/mol |
| Exact Mass | 401.18 |
| IUPAC Name | [(8R,9S,10R,13S,14S,17R)-17-acetyl-10,13-dimethyl-6-methylidene-2,3-dioxo-7,8,9,11,12,14,15,16-octahydro-1H-cyclopenta[a]phenanthren-17-yl] nitrate |
| SMILES | C=C1C[C@@H]2[C@H](CC[C@@]3(C)[C@H]2CC[C@]3(O[N+](=O)[O-])C(C)=O)[C@@]2(C)CC(=O)C(=O)C=C12 |
| InChI | InChI=1S/C22H27NO6/c1-12-9-14-15(20(3)11-19(26)18(25)10-17(12)20)5-7-21(4)16(14)6-8-22(21,13(2)24)29-23(27)28/h10,14-16H,1,5-9,11H2,2-4H3/t14-,15+,16+,20-,21+,22+/m1/s1 |
| InChIKey | YNAJOVOTELZDRA-OFUYBIASSA-N |
| XLogP | 3.40 |
| TPSA | 103.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.46 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|