C26H34O4 — CID 57150944
(8R,9S,10S,13S,14S,17R)-17-acetyl-17-(methoxymethoxy)-10,13-dimethyl-1,2,6-trimethylidene-7,8,9,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-3-one (PubChem CID 57150944) has the molecular formula C26H34O4 and a molecular weight of 410.55 g/mol. Its IUPAC name is (8R,9S,10S,13S,14S,17R)-17-acetyl-17-(methoxymethoxy)-10,13-dimethyl-1,2,6-trimethylidene-7,8,9,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-3-one.
| Compound Name | (8R,9S,10S,13S,14S,17R)-17-acetyl-17-(methoxymethoxy)-10,13-dimethyl-1,2,6-trimethylidene-7,8,9,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 57150944 |
| Molecular Formula | C26H34O4 |
| Molecular Weight | 410.55 g/mol |
| Exact Mass | 410.25 |
| IUPAC Name | (8R,9S,10S,13S,14S,17R)-17-acetyl-17-(methoxymethoxy)-10,13-dimethyl-1,2,6-trimethylidene-7,8,9,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-3-one |
| SMILES | C=C1C[C@@H]2[C@H](CC[C@@]3(C)[C@H]2CC[C@]3(OCOC)C(C)=O)[C@@]2(C)C(=C)C(=C)C(=O)C=C12 |
| InChI | InChI=1S/C26H34O4/c1-15-12-19-20-9-11-26(18(4)27,30-14-29-7)24(20,5)10-8-21(19)25(6)17(3)16(2)23(28)13-22(15)25/h13,19-21H,1-3,8-12,14H2,4-7H3/t19-,20-,21-,24-,25+,26-/m0/s1 |
| InChIKey | HFTWUHRMOOCHPD-YRNRXMGWSA-N |
| XLogP | 4.96 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.55 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|